C5H6Cl3NO2 — CID 131879242
1,1,1-trichloro-3-nitropent-2-ene (PubChem CID 131879242) has the molecular formula C5H6Cl3NO2 and a molecular weight of 218.47 g/mol. Its IUPAC name is 1,1,1-trichloro-3-nitropent-2-ene.
| Compound Name | 1,1,1-trichloro-3-nitropent-2-ene |
|---|---|
| PubChem CID | 131879242 |
| Molecular Formula | C5H6Cl3NO2 |
| Molecular Weight | 218.47 g/mol |
| Exact Mass | 216.95 |
| IUPAC Name | 1,1,1-trichloro-3-nitropent-2-ene |
| SMILES | CCC(=CC(Cl)(Cl)Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C5H6Cl3NO2/c1-2-4(9(10)11)3-5(6,7)8/h3H,2H2,1H3 |
| InChIKey | GHRVHNLCNGEHMV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|