C12H15NO2S — CID 139607992
1,3-dimethyl-2-(2-nitrobut-1-enylsulfanyl)benzene (PubChem CID 139607992) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 1,3-dimethyl-2-(2-nitrobut-1-enylsulfanyl)benzene.
| Compound Name | 1,3-dimethyl-2-(2-nitrobut-1-enylsulfanyl)benzene |
|---|---|
| PubChem CID | 139607992 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1,3-dimethyl-2-(2-nitrobut-1-enylsulfanyl)benzene |
| SMILES | CCC(=CSc1c(C)cccc1C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H15NO2S/c1-4-11(13(14)15)8-16-12-9(2)6-5-7-10(12)3/h5-8H,4H2,1-3H3 |
| InChIKey | LXLFNWBBLULRAW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|