C19H32BClN2O5 — CID 168920099
(2R)-2-amino-3-methoxy-N-[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide;hydrochloride (PubChem CID 168920099) has the molecular formula C19H32BClN2O5 and a molecular weight of 414.74 g/mol. Its IUPAC name is (2R)-2-amino-3-methoxy-N-[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-3-methoxy-N-[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 168920099 |
| Molecular Formula | C19H32BClN2O5 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (2R)-2-amino-3-methoxy-N-[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide;hydrochloride |
| SMILES | COC[C@@H](N)C(=O)N[C@@H](CCOc1ccccc1)B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C19H31BN2O5.ClH/c1-18(2)19(3,4)27-20(26-18)16(22-17(23)15(21)13-24-5)11-12-25-14-9-7-6-8-10-14;/h6-10,15-16H,11-13,21H2,1-5H3,(H,22,23);1H/t15-,16+;/m1./s1 |
| InChIKey | IJQYJVJAIFTDKW-RCPFAERMSA-N |
| XLogP | 1.97 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|