C25H32BF3N4O6 — CID 168920163
N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-2-(trifluoromethyl)pyrimidine-4-carboxamide (PubChem CID 168920163) has the molecular formula C25H32BF3N4O6 and a molecular weight of 552.36 g/mol. Its IUPAC name is N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-2-(trifluoromethyl)pyrimidine-4-carboxamide.
| Compound Name | N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-2-(trifluoromethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 168920163 |
| Molecular Formula | C25H32BF3N4O6 |
| Molecular Weight | 552.36 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-2-(trifluoromethyl)pyrimidine-4-carboxamide |
| SMILES | COC[C@@H](NC(=O)c1ccnc(C(F)(F)F)n1)C(=O)N[C@@H](CCOc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H32BF3N4O6/c1-23(2)24(3,4)39-26(38-23)19(12-14-37-16-9-7-6-8-10-16)33-21(35)18(15-36-5)31-20(34)17-11-13-30-22(32-17)25(27,28)29/h6-11,13,18-19H,12,14-15H2,1-5H3,(H,31,34)(H,33,35)/t18-,19+/m1/s1 |
| InChIKey | VCRKORVADNNRJK-MOPGFXCFSA-N |
| XLogP | 2.83 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|