C26H36BN3O6 — CID 174051478
N-[3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-5-methylpyridine-3-carboxamide (PubChem CID 174051478) has the molecular formula C26H36BN3O6 and a molecular weight of 497.40 g/mol. Its IUPAC name is N-[3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-[3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 174051478 |
| Molecular Formula | C26H36BN3O6 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-[3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-5-methylpyridine-3-carboxamide |
| SMILES | COCC(NC(=O)c1cncc(C)c1)C(=O)N[C@@H](CCOc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H36BN3O6/c1-18-14-19(16-28-15-18)23(31)29-21(17-33-6)24(32)30-22(12-13-34-20-10-8-7-9-11-20)27-35-25(2,3)26(4,5)36-27/h7-11,14-16,21-22H,12-13,17H2,1-6H3,(H,29,31)(H,30,32)/t21?,22-/m0/s1 |
| InChIKey | LZVLDUUGRSRJGR-KEKNWZKVSA-N |
| XLogP | 2.72 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|