C26H36BN3O6 — CID 177297152
3-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-6-methylpyridine-2-carboxamide (PubChem CID 177297152) has the molecular formula C26H36BN3O6 and a molecular weight of 497.40 g/mol. Its IUPAC name is 3-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-6-methylpyridine-2-carboxamide.
| Compound Name | 3-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 177297152 |
| Molecular Formula | C26H36BN3O6 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 3-[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]-6-methylpyridine-2-carboxamide |
| SMILES | COC[C@H](C(=O)N[C@@H](CCOc1ccccc1)B1OC(C)(C)C(C)(C)O1)c1ccc(C)nc1C(N)=O |
| InChI | InChI=1S/C26H36BN3O6/c1-17-12-13-19(22(29-17)23(28)31)20(16-33-6)24(32)30-21(14-15-34-18-10-8-7-9-11-18)27-35-25(2,3)26(4,5)36-27/h7-13,20-21H,14-16H2,1-6H3,(H2,28,31)(H,30,32)/t20-,21-/m0/s1 |
| InChIKey | NUYHTWGNVVFLRN-SFTDATJTSA-N |
| XLogP | 2.80 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|