C21H33BN2O6 — CID 174052042
[(2R)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl] carbamate (PubChem CID 174052042) has the molecular formula C21H33BN2O6 and a molecular weight of 420.32 g/mol. Its IUPAC name is [(2R)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl] carbamate.
| Compound Name | [(2R)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl] carbamate |
|---|---|
| PubChem CID | 174052042 |
| Molecular Formula | C21H33BN2O6 |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | [(2R)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl] carbamate |
| SMILES | COC[C@@H](OC(N)=O)C(=O)N[C@@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H33BN2O6/c1-20(2)21(3,4)30-22(29-20)17(13-9-12-15-10-7-6-8-11-15)24-18(25)16(14-27-5)28-19(23)26/h6-8,10-11,16-17H,9,12-14H2,1-5H3,(H2,23,26)(H,24,25)/t16-,17+/m1/s1 |
| InChIKey | LJZGINJQQLKAAC-SJORKVTESA-N |
| XLogP | 2.24 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|