C25H35BN4O5 — CID 177297142
3-[(2R)-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-(trideuteriomethoxy)propan-2-yl]pyrazine-2-carboxamide (PubChem CID 177297142) has the molecular formula C25H35BN4O5 and a molecular weight of 485.41 g/mol. Its IUPAC name is 3-[(2R)-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-(trideuteriomethoxy)propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3-[(2R)-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-(trideuteriomethoxy)propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 177297142 |
| Molecular Formula | C25H35BN4O5 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 3-[(2R)-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-(trideuteriomethoxy)propan-2-yl]pyrazine-2-carboxamide |
| SMILES | [2H]C([2H])([2H])OC[C@H](C(=O)N[C@@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1)c1nccnc1C(N)=O |
| InChI | InChI=1S/C25H35BN4O5/c1-24(2)25(3,4)35-26(34-24)19(13-9-12-17-10-7-6-8-11-17)30-23(32)18(16-33-5)20-21(22(27)31)29-15-14-28-20/h6-8,10-11,14-15,18-19H,9,12-13,16H2,1-5H3,(H2,27,31)(H,30,32)/t18-,19-/m0/s1/i5D3 |
| InChIKey | XJHSPSJWDVGVOO-AQNWUDQMSA-N |
| XLogP | 2.44 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|