C27H37BN2O6 — CID 174052185
[1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamic acid (PubChem CID 174052185) has the molecular formula C27H37BN2O6 and a molecular weight of 496.41 g/mol. Its IUPAC name is [1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamic acid.
| Compound Name | [1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174052185 |
| Molecular Formula | C27H37BN2O6 |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | [1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamic acid |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)C(COCc2ccccc2)NC(=O)O)OC1(C)C |
| InChI | InChI=1S/C27H37BN2O6/c1-26(2)27(3,4)36-28(35-26)23(17-11-16-20-12-7-5-8-13-20)30-24(31)22(29-25(32)33)19-34-18-21-14-9-6-10-15-21/h5-10,12-15,22-23,29H,11,16-19H2,1-4H3,(H,30,31)(H,32,33)/t22?,23-/m0/s1 |
| InChIKey | VDPRBPUUPZDEEC-WCSIJFPASA-N |
| XLogP | 3.98 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|