C20H31BN2O7 — CID 174049843
[(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]carbamic acid (PubChem CID 174049843) has the molecular formula C20H31BN2O7 and a molecular weight of 422.29 g/mol. Its IUPAC name is [(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]carbamic acid.
| Compound Name | [(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174049843 |
| Molecular Formula | C20H31BN2O7 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [(2R)-3-methoxy-1-oxo-1-[[(1R)-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]propan-2-yl]carbamic acid |
| SMILES | COC[C@@H](NC(=O)O)C(=O)N[C@@H](CCOc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H31BN2O7/c1-19(2)20(3,4)30-21(29-19)16(11-12-28-14-9-7-6-8-10-14)23-17(24)15(13-27-5)22-18(25)26/h6-10,15-16,22H,11-13H2,1-5H3,(H,23,24)(H,25,26)/t15-,16+/m1/s1 |
| InChIKey | ZHEYLVGBUIPLTJ-CVEARBPZSA-N |
| XLogP | 1.85 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|