C20H31BN4O6 — CID 168919882
[(1R)-1-[[(2R)-2-(methylcarbamoylamino)-4-morpholin-4-yl-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 168919882) has the molecular formula C20H31BN4O6 and a molecular weight of 434.30 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-(methylcarbamoylamino)-4-morpholin-4-yl-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-(methylcarbamoylamino)-4-morpholin-4-yl-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 168919882 |
| Molecular Formula | C20H31BN4O6 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(1R)-1-[[(2R)-2-(methylcarbamoylamino)-4-morpholin-4-yl-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | CNC(=O)N[C@H](CC(=O)N1CCOCC1)C(=O)N[C@@H](CCCc1ccccc1)B(O)O |
| InChI | InChI=1S/C20H31BN4O6/c1-22-20(28)23-16(14-18(26)25-10-12-31-13-11-25)19(27)24-17(21(29)30)9-5-8-15-6-3-2-4-7-15/h2-4,6-7,16-17,29-30H,5,8-14H2,1H3,(H,24,27)(H2,22,23,28)/t16-,17+/m1/s1 |
| InChIKey | SBIJBFRMFNQRCP-SJORKVTESA-N |
| XLogP | -0.95 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|