C24H36BN3O7 — CID 174052168
[(1R)-1-[[4-morpholin-4-yl-2-(oxane-2-carbonylamino)-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 174052168) has the molecular formula C24H36BN3O7 and a molecular weight of 489.38 g/mol. Its IUPAC name is [(1R)-1-[[4-morpholin-4-yl-2-(oxane-2-carbonylamino)-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[4-morpholin-4-yl-2-(oxane-2-carbonylamino)-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 174052168 |
| Molecular Formula | C24H36BN3O7 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | [(1R)-1-[[4-morpholin-4-yl-2-(oxane-2-carbonylamino)-4-oxobutanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | O=C(N[C@@H](CCCc1ccccc1)B(O)O)C(CC(=O)N1CCOCC1)NC(=O)C1CCCCO1 |
| InChI | InChI=1S/C24H36BN3O7/c29-22(28-12-15-34-16-13-28)17-19(26-24(31)20-10-4-5-14-35-20)23(30)27-21(25(32)33)11-6-9-18-7-2-1-3-8-18/h1-3,7-8,19-21,32-33H,4-6,9-17H2,(H,26,31)(H,27,30)/t19?,20?,21-/m0/s1 |
| InChIKey | MFEFTMRFRSEKHT-CBNMVNINSA-N |
| XLogP | -0.19 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|