C19H25BN4O6S — CID 168919656
[(1R)-1-[[(2S)-3-methylsulfonyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 168919656) has the molecular formula C19H25BN4O6S and a molecular weight of 448.31 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-3-methylsulfonyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-3-methylsulfonyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 168919656 |
| Molecular Formula | C19H25BN4O6S |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [(1R)-1-[[(2S)-3-methylsulfonyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | CS(=O)(=O)C[C@@H](NC(=O)c1cnccn1)C(=O)N[C@@H](CCCc1ccccc1)B(O)O |
| InChI | InChI=1S/C19H25BN4O6S/c1-31(29,30)13-16(23-18(25)15-12-21-10-11-22-15)19(26)24-17(20(27)28)9-5-8-14-6-3-2-4-7-14/h2-4,6-7,10-12,16-17,27-28H,5,8-9,13H2,1H3,(H,23,25)(H,24,26)/t16-,17+/m1/s1 |
| InChIKey | NMIAAGHBSBDCGO-SJORKVTESA-N |
| XLogP | -0.86 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|