C29H37BN4O6 — CID 168920256
N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide (PubChem CID 168920256) has the molecular formula C29H37BN4O6 and a molecular weight of 548.45 g/mol. Its IUPAC name is N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168920256 |
| Molecular Formula | C29H37BN4O6 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | N-[(2R)-3-methoxy-1-oxo-1-[[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
| SMILES | COC[C@@H](NC(=O)c1cnccn1)C(=O)N[C@@H](CCC(=O)c1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C29H37BN4O6/c1-28(2)19-14-23(28)29(3)24(15-19)39-30(40-29)25(11-10-22(35)18-8-6-5-7-9-18)34-27(37)21(17-38-4)33-26(36)20-16-31-12-13-32-20/h5-9,12-13,16,19,21,23-25H,10-11,14-15,17H2,1-4H3,(H,33,36)(H,34,37)/t19-,21+,23-,24+,25-,29-/m0/s1 |
| InChIKey | DZUMIQPUGVIDNJ-QOFYDZEZSA-N |
| XLogP | 2.64 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|