C28H37BN4O4 — CID 163614781
N-[(2S)-1-[[(1R)-1-[(2S,6R,8S,9R)-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide (PubChem CID 163614781) has the molecular formula C28H37BN4O4 and a molecular weight of 504.44 g/mol. Its IUPAC name is N-[(2S)-1-[[(1R)-1-[(2S,6R,8S,9R)-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(1R)-1-[(2S,6R,8S,9R)-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 163614781 |
| Molecular Formula | C28H37BN4O4 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | N-[(2S)-1-[[(1R)-1-[(2S,6R,8S,9R)-2,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B1O[C@@H]2C[C@@H]3CC([C@@H]3C)[C@]2(C)O1 |
| InChI | InChI=1S/C28H37BN4O4/c1-17(2)12-25(29-36-24-15-20-14-21(18(20)3)28(24,4)37-29)33-26(34)22(13-19-8-6-5-7-9-19)32-27(35)23-16-30-10-11-31-23/h5-11,16-18,20-22,24-25H,12-15H2,1-4H3,(H,32,35)(H,33,34)/t18-,20+,21?,22+,24-,25+,28+/m1/s1 |
| InChIKey | HJAVLYBVNOPYNG-YHQXQFJXSA-N |
| XLogP | 3.23 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|