C25H31BN4O7 — CID 140759207
N-[(2S)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide (PubChem CID 140759207) has the molecular formula C25H31BN4O7 and a molecular weight of 510.36 g/mol. Its IUPAC name is N-[(2S)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 140759207 |
| Molecular Formula | C25H31BN4O7 |
| Molecular Weight | 510.36 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[(2S)-1-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B1OC(=O)[C@H](C)O[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C25H31BN4O7/c1-15(2)12-21(26-36-24(33)16(3)35-17(4)25(34)37-26)30-22(31)19(13-18-8-6-5-7-9-18)29-23(32)20-14-27-10-11-28-20/h5-11,14-17,19,21H,12-13H2,1-4H3,(H,29,32)(H,30,31)/t16-,17+,19-,21-/m0/s1 |
| InChIKey | GNRYWCCANOZDSF-NZGUISNBSA-N |
| XLogP | 1.27 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|