C26H34BN5O6 — CID 154504699
N-[(2S)-1-[[(1R)-1-[(8R)-6,8-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide (PubChem CID 154504699) has the molecular formula C26H34BN5O6 and a molecular weight of 523.40 g/mol. Its IUPAC name is N-[(2S)-1-[[(1R)-1-[(8R)-6,8-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(1R)-1-[(8R)-6,8-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 154504699 |
| Molecular Formula | C26H34BN5O6 |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | N-[(2S)-1-[[(1R)-1-[(8R)-6,8-dimethyl-4,9-dioxo-1,3,6,2-dioxazaboronan-2-yl]-3-methylbutyl]amino]-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B1OC(=O)CN(C)C[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C26H34BN5O6/c1-17(2)12-22(27-37-23(33)16-32(4)15-18(3)26(36)38-27)31-24(34)20(13-19-8-6-5-7-9-19)30-25(35)21-14-28-10-11-29-21/h5-11,14,17-18,20,22H,12-13,15-16H2,1-4H3,(H,30,35)(H,31,34)/t18-,20+,22+/m1/s1 |
| InChIKey | BCEKXKXUTFSVDQ-CBQOVEMMSA-N |
| XLogP | 1.04 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|