C27H37BN4O5 — CID 147414347
N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-[(5R,7R)-5,6,7-trimethyl-4-oxo-1,3,6,2-dioxazaborocan-2-yl]octan-2-yl]pyrazine-2-carboxamide (PubChem CID 147414347) has the molecular formula C27H37BN4O5 and a molecular weight of 508.43 g/mol. Its IUPAC name is N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-[(5R,7R)-5,6,7-trimethyl-4-oxo-1,3,6,2-dioxazaborocan-2-yl]octan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-[(5R,7R)-5,6,7-trimethyl-4-oxo-1,3,6,2-dioxazaborocan-2-yl]octan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 147414347 |
| Molecular Formula | C27H37BN4O5 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-[(5R,7R)-5,6,7-trimethyl-4-oxo-1,3,6,2-dioxazaborocan-2-yl]octan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H](CC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B1OC[C@@H](C)N(C)[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C27H37BN4O5/c1-18(2)13-22(28-36-17-19(3)32(5)20(4)27(35)37-28)15-25(33)23(14-21-9-7-6-8-10-21)31-26(34)24-16-29-11-12-30-24/h6-12,16,18-20,22-23H,13-15,17H2,1-5H3,(H,31,34)/t19-,20-,22-,23+/m1/s1 |
| InChIKey | DRFMFDJFSSMUJY-PRTQVNTJSA-N |
| XLogP | 2.96 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|