C31H48BN3O5 — CID 174000644
tert-butyl (2S)-2-[[[(1R)-3-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamoylamino]methyl]piperidine-1-carboxylate (PubChem CID 174000644) has the molecular formula C31H48BN3O5 and a molecular weight of 553.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[(1R)-3-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamoylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[[(1R)-3-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamoylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174000644 |
| Molecular Formula | C31H48BN3O5 |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.37 |
| IUPAC Name | tert-butyl (2S)-2-[[[(1R)-3-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]carbamoylamino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1CNC(=O)N[C@@H](CCc1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C31H48BN3O5/c1-29(2,3)38-28(37)35-17-11-10-14-23(35)20-33-27(36)34-26(16-15-21-12-8-7-9-13-21)32-39-25-19-22-18-24(30(22,4)5)31(25,6)40-32/h7-9,12-13,22-26H,10-11,14-20H2,1-6H3,(H2,33,34,36)/t22-,23-,24-,25+,26-,31-/m0/s1 |
| InChIKey | XIJHHOIDXGPUMC-CYCPZHCKSA-N |
| XLogP | 5.34 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|