C31H43BN2O7 — CID 158635522
tert-butyl 2-[[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyloxymethyl]pyrrolidine-1-carboxylate (PubChem CID 158635522) has the molecular formula C31H43BN2O7 and a molecular weight of 566.50 g/mol. Its IUPAC name is tert-butyl 2-[[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyloxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyloxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158635522 |
| Molecular Formula | C31H43BN2O7 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | tert-butyl 2-[[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyloxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COC(=O)N[C@@H](Cc1coc2ccccc12)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C31H43BN2O7/c1-29(2,3)39-28(36)34-13-9-10-21(34)18-38-27(35)33-26(14-19-17-37-23-12-8-7-11-22(19)23)32-40-25-16-20-15-24(30(20,4)5)31(25,6)41-32/h7-8,11-12,17,20-21,24-26H,9-10,13-16,18H2,1-6H3,(H,33,35)/t20-,21?,24-,25+,26-,31-/m0/s1 |
| InChIKey | HZSLHKSZQIUKHK-CNBYDNSYSA-N |
| XLogP | 5.74 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|