C27H36BNO5 — CID 158622928
cyclohexyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate (PubChem CID 158622928) has the molecular formula C27H36BNO5 and a molecular weight of 465.40 g/mol. Its IUPAC name is cyclohexyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate.
| Compound Name | cyclohexyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 158622928 |
| Molecular Formula | C27H36BNO5 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | cyclohexyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4coc5ccccc45)NC(=O)OC4CCCCC4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C27H36BNO5/c1-26(2)18-14-22(26)27(3)23(15-18)33-28(34-27)24(29-25(30)32-19-9-5-4-6-10-19)13-17-16-31-21-12-8-7-11-20(17)21/h7-8,11-12,16,18-19,22-24H,4-6,9-10,13-15H2,1-3H3,(H,29,30)/t18-,22-,23+,24-,27-/m0/s1 |
| InChIKey | LZWKYJXZLVJHOO-YUFFHVAUSA-N |
| XLogP | 5.67 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|