C34H40BNO5 — CID 164899450
N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-spiro[2H-1-benzofuran-3,1'-cyclopentane]-6-ylacetamide (PubChem CID 164899450) has the molecular formula C34H40BNO5 and a molecular weight of 553.51 g/mol. Its IUPAC name is N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-spiro[2H-1-benzofuran-3,1'-cyclopentane]-6-ylacetamide.
| Compound Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-spiro[2H-1-benzofuran-3,1'-cyclopentane]-6-ylacetamide |
|---|---|
| PubChem CID | 164899450 |
| Molecular Formula | C34H40BNO5 |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-spiro[2H-1-benzofuran-3,1'-cyclopentane]-6-ylacetamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4coc5ccccc45)NC(=O)Cc4ccc5c(c4)OCC54CCCC4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C34H40BNO5/c1-32(2)23-17-28(32)33(3)29(18-23)40-35(41-33)30(16-22-19-38-26-9-5-4-8-24(22)26)36-31(37)15-21-10-11-25-27(14-21)39-20-34(25)12-6-7-13-34/h4-5,8-11,14,19,23,28-30H,6-7,12-13,15-18,20H2,1-3H3,(H,36,37)/t23-,28-,29+,30-,33-/m0/s1 |
| InChIKey | MAKLJXHVEGYAHF-YUCOWNEHSA-N |
| XLogP | 6.17 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|