C33H36BN3O5 — CID 166523968
N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(6-oxo-8,9-dihydro-7H-pyrido[3,2-b]indolizin-5-yl)acetamide (PubChem CID 166523968) has the molecular formula C33H36BN3O5 and a molecular weight of 565.48 g/mol. Its IUPAC name is N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(6-oxo-8,9-dihydro-7H-pyrido[3,2-b]indolizin-5-yl)acetamide.
| Compound Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(6-oxo-8,9-dihydro-7H-pyrido[3,2-b]indolizin-5-yl)acetamide |
|---|---|
| PubChem CID | 166523968 |
| Molecular Formula | C33H36BN3O5 |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(6-oxo-8,9-dihydro-7H-pyrido[3,2-b]indolizin-5-yl)acetamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4coc5ccccc45)NC(=O)Cc4c5n(c6ncccc46)CCCC5=O)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C33H36BN3O5/c1-32(2)20-15-26(32)33(3)27(16-20)41-34(42-33)28(14-19-18-40-25-11-5-4-8-21(19)25)36-29(39)17-23-22-9-6-12-35-31(22)37-13-7-10-24(38)30(23)37/h4-6,8-9,11-12,18,20,26-28H,7,10,13-17H2,1-3H3,(H,36,39)/t20-,26-,27+,28-,33-/m0/s1 |
| InChIKey | LUOPTIGEYLJXME-OQXIOANDSA-N |
| XLogP | 5.30 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|