C20H24BClO3 — CID 129317976
(2S,6S)-4-[2-(1-benzofuran-3-yl)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 129317976) has the molecular formula C20H24BClO3 and a molecular weight of 358.67 g/mol. Its IUPAC name is (2S,6S)-4-[2-(1-benzofuran-3-yl)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (2S,6S)-4-[2-(1-benzofuran-3-yl)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 129317976 |
| Molecular Formula | C20H24BClO3 |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2S,6S)-4-[2-(1-benzofuran-3-yl)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC1(C)C2CC1[C@]1(C)OB(C(Cl)Cc3coc4ccccc34)O[C@H]1C2 |
| InChI | InChI=1S/C20H24BClO3/c1-19(2)13-9-16(19)20(3)17(10-13)24-21(25-20)18(22)8-12-11-23-15-7-5-4-6-14(12)15/h4-7,11,13,16-18H,8-10H2,1-3H3/t13?,16?,17-,18?,20-/m0/s1 |
| InChIKey | PZOWHHFGAQKJTI-MQDSZSMUSA-N |
| XLogP | 4.85 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|