C21H28BClO3 — CID 159481958
1-[3-[(2R)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylphenyl]ethanone (PubChem CID 159481958) has the molecular formula C21H28BClO3 and a molecular weight of 374.72 g/mol. Its IUPAC name is 1-[3-[(2R)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylphenyl]ethanone.
| Compound Name | 1-[3-[(2R)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylphenyl]ethanone |
|---|---|
| PubChem CID | 159481958 |
| Molecular Formula | C21H28BClO3 |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-[3-[(2R)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(C[C@H](Cl)B2OC3CC4CC(C4(C)C)[C@]3(C)O2)c1C |
| InChI | InChI=1S/C21H28BClO3/c1-12-14(7-6-8-16(12)13(2)24)9-19(23)22-25-18-11-15-10-17(20(15,3)4)21(18,5)26-22/h6-8,15,17-19H,9-11H2,1-5H3/t15?,17?,18?,19-,21-/m0/s1 |
| InChIKey | YWUAERACWMYAPO-XBIVUFGSSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|