C27H30BCl2NO6 — CID 142704718
3-[2-[(2,6-dichlorobenzoyl)amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoic acid (PubChem CID 142704718) has the molecular formula C27H30BCl2NO6 and a molecular weight of 546.26 g/mol. Its IUPAC name is 3-[2-[(2,6-dichlorobenzoyl)amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoic acid.
| Compound Name | 3-[2-[(2,6-dichlorobenzoyl)amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 142704718 |
| Molecular Formula | C27H30BCl2NO6 |
| Molecular Weight | 546.26 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 3-[2-[(2,6-dichlorobenzoyl)amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoic acid |
| SMILES | COc1c(CC(NC(=O)c2c(Cl)cccc2Cl)B2OC3CC4CC(C4(C)C)C3(C)O2)cccc1C(=O)O |
| InChI | InChI=1S/C27H30BCl2NO6/c1-26(2)15-12-19(26)27(3)20(13-15)36-28(37-27)21(31-24(32)22-17(29)9-6-10-18(22)30)11-14-7-5-8-16(25(33)34)23(14)35-4/h5-10,15,19-21H,11-13H2,1-4H3,(H,31,32)(H,33,34) |
| InChIKey | MEDWQRHPIJYJQU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.26 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|