C37H57BN2O8 — CID 90218898
tert-butyl 2-methoxy-3-[(2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate (PubChem CID 90218898) has the molecular formula C37H57BN2O8 and a molecular weight of 668.68 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-[(2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate.
| Compound Name | tert-butyl 2-methoxy-3-[(2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 90218898 |
| Molecular Formula | C37H57BN2O8 |
| Molecular Weight | 668.68 g/mol |
| Exact Mass | 668.42 |
| IUPAC Name | tert-butyl 2-methoxy-3-[(2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
| SMILES | COc1c(C[C@H](NC(=O)C2CCC(CNC(=O)OC(C)(C)C)CC2)B2OC3CC4CC(C4(C)C)C3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H57BN2O8/c1-34(2,3)45-32(42)26-13-11-12-24(30(26)44-10)18-29(38-47-28-20-25-19-27(36(25,7)8)37(28,9)48-38)40-31(41)23-16-14-22(15-17-23)21-39-33(43)46-35(4,5)6/h11-13,22-23,25,27-29H,14-21H2,1-10H3,(H,39,43)(H,40,41)/t22?,23?,25?,27?,28?,29-,37?/m0/s1 |
| InChIKey | LYVMMVAAQGQIHR-SKSXZUAZSA-N |
| XLogP | 6.28 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|