C31H47BN4O6Si — CID 140778342
tert-butyl 2-methoxy-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-2-[[2-(4-trimethylsilyltriazol-1-yl)acetyl]amino]ethyl]benzoate (PubChem CID 140778342) has the molecular formula C31H47BN4O6Si and a molecular weight of 610.64 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-2-[[2-(4-trimethylsilyltriazol-1-yl)acetyl]amino]ethyl]benzoate.
| Compound Name | tert-butyl 2-methoxy-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-2-[[2-(4-trimethylsilyltriazol-1-yl)acetyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 140778342 |
| Molecular Formula | C31H47BN4O6Si |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | tert-butyl 2-methoxy-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-2-[[2-(4-trimethylsilyltriazol-1-yl)acetyl]amino]ethyl]benzoate |
| SMILES | COc1c(C[C@H](NC(=O)Cn2cc([Si](C)(C)C)nn2)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H47BN4O6Si/c1-29(2,3)40-28(38)21-13-11-12-19(27(21)39-7)14-24(33-25(37)17-36-18-26(34-35-36)43(8,9)10)32-41-23-16-20-15-22(30(20,4)5)31(23,6)42-32/h11-13,18,20,22-24H,14-17H2,1-10H3,(H,33,37)/t20-,22-,23+,24-,31-/m0/s1 |
| InChIKey | DCYIORGMUNFUSU-ITNAAXFCSA-N |
| XLogP | 3.78 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|