C38H57BN6O8 — CID 145273937
tert-butyl 3-[2-[[2-[4,5-bis(morpholin-4-ylmethyl)triazol-1-yl]acetyl]amino]-2-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate (PubChem CID 145273937) has the molecular formula C38H57BN6O8 and a molecular weight of 736.72 g/mol. Its IUPAC name is tert-butyl 3-[2-[[2-[4,5-bis(morpholin-4-ylmethyl)triazol-1-yl]acetyl]amino]-2-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate.
| Compound Name | tert-butyl 3-[2-[[2-[4,5-bis(morpholin-4-ylmethyl)triazol-1-yl]acetyl]amino]-2-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 145273937 |
| Molecular Formula | C38H57BN6O8 |
| Molecular Weight | 736.72 g/mol |
| Exact Mass | 736.43 |
| IUPAC Name | tert-butyl 3-[2-[[2-[4,5-bis(morpholin-4-ylmethyl)triazol-1-yl]acetyl]amino]-2-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate |
| SMILES | COc1c(CC(NC(=O)Cn2nnc(CN3CCOCC3)c2CN2CCOCC2)B2O[C@@H]3C[C@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H57BN6O8/c1-36(2,3)51-35(47)27-10-8-9-25(34(27)48-7)19-32(39-52-31-21-26-20-30(37(26,4)5)38(31,6)53-39)40-33(46)24-45-29(23-44-13-17-50-18-14-44)28(41-42-45)22-43-11-15-49-16-12-43/h8-10,26,30-32H,11-24H2,1-7H3,(H,40,46)/t26-,30+,31-,32?,38+/m1/s1 |
| InChIKey | HNXKXFBZXNSRNC-BNTXLYIYSA-N |
| XLogP | 2.90 |
| TPSA | 138.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.72 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|