C34H46BClN2O8 — CID 151959894
tert-butyl 3-[(2R)-2-[[2-amino-2-(2-chloro-3,4-dimethoxyphenyl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate (PubChem CID 151959894) has the molecular formula C34H46BClN2O8 and a molecular weight of 657.01 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-2-[[2-amino-2-(2-chloro-3,4-dimethoxyphenyl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate.
| Compound Name | tert-butyl 3-[(2R)-2-[[2-amino-2-(2-chloro-3,4-dimethoxyphenyl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 151959894 |
| Molecular Formula | C34H46BClN2O8 |
| Molecular Weight | 657.01 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | tert-butyl 3-[(2R)-2-[[2-amino-2-(2-chloro-3,4-dimethoxyphenyl)acetyl]amino]-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxybenzoate |
| SMILES | COc1ccc(C(N)C(=O)N[C@@H](Cc2cccc(C(=O)OC(C)(C)C)c2OC)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)c(Cl)c1OC |
| InChI | InChI=1S/C34H46BClN2O8/c1-32(2,3)44-31(40)21-12-10-11-18(28(21)42-8)15-25(35-45-24-17-19-16-23(33(19,4)5)34(24,6)46-35)38-30(39)27(37)20-13-14-22(41-7)29(43-9)26(20)36/h10-14,19,23-25,27H,15-17,37H2,1-9H3,(H,38,39)/t19-,23-,24+,25-,27?,34-/m0/s1 |
| InChIKey | TYKTUGXYMPLGTQ-VEAMQELHSA-N |
| XLogP | 5.32 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.01 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|