C35H54BN3O8 — CID 90461435
tert-butyl 2-methoxy-3-[2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate (PubChem CID 90461435) has the molecular formula C35H54BN3O8 and a molecular weight of 655.64 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-[2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate.
| Compound Name | tert-butyl 2-methoxy-3-[2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 90461435 |
| Molecular Formula | C35H54BN3O8 |
| Molecular Weight | 655.64 g/mol |
| Exact Mass | 655.40 |
| IUPAC Name | tert-butyl 2-methoxy-3-[2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
| SMILES | COc1c(CC(NC(=O)CN2CCC(NC(=O)OC(C)(C)C)C2)B2OC3CC4CC(C4(C)C)C3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H54BN3O8/c1-32(2,3)44-30(41)24-13-11-12-21(29(24)43-10)16-27(36-46-26-18-22-17-25(34(22,7)8)35(26,9)47-36)38-28(40)20-39-15-14-23(19-39)37-31(42)45-33(4,5)6/h11-13,22-23,25-27H,14-20H2,1-10H3,(H,37,42)(H,38,40) |
| InChIKey | POPXUWRXAPLQMO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|