C31H44BN3O6 — CID 162255696
tert-butyl 2-methoxy-3-[(2R)-4-oxo-4-(1-propyltriazol-4-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]benzoate (PubChem CID 162255696) has the molecular formula C31H44BN3O6 and a molecular weight of 565.52 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-[(2R)-4-oxo-4-(1-propyltriazol-4-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]benzoate.
| Compound Name | tert-butyl 2-methoxy-3-[(2R)-4-oxo-4-(1-propyltriazol-4-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]benzoate |
|---|---|
| PubChem CID | 162255696 |
| Molecular Formula | C31H44BN3O6 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | tert-butyl 2-methoxy-3-[(2R)-4-oxo-4-(1-propyltriazol-4-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]benzoate |
| SMILES | CCCn1cc(C(=O)C[C@@H](Cc2cccc(C(=O)OC(C)(C)C)c2OC)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)nn1 |
| InChI | InChI=1S/C31H44BN3O6/c1-9-13-35-18-23(33-34-35)24(36)17-21(32-40-26-16-20-15-25(30(20,5)6)31(26,7)41-32)14-19-11-10-12-22(27(19)38-8)28(37)39-29(2,3)4/h10-12,18,20-21,25-26H,9,13-17H2,1-8H3/t20-,21+,25-,26+,31-/m0/s1 |
| InChIKey | LABMFVSAWPOKEG-UWIYKQGGSA-N |
| XLogP | 5.57 |
| TPSA | 101.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|