C35H50BNO8 — CID 131749683
2-methoxy-3-[2-[3-(2,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl)propanoylamino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoic acid (PubChem CID 131749683) has the molecular formula C35H50BNO8 and a molecular weight of 623.60 g/mol. Its IUPAC name is 2-methoxy-3-[2-[3-(2,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl)propanoylamino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoic acid.
| Compound Name | 2-methoxy-3-[2-[3-(2,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl)propanoylamino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 131749683 |
| Molecular Formula | C35H50BNO8 |
| Molecular Weight | 623.60 g/mol |
| Exact Mass | 623.36 |
| IUPAC Name | 2-methoxy-3-[2-[3-(2,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl)propanoylamino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoic acid |
| SMILES | COc1c(CC(NC(=O)CCC2(C)OC3CC4CC(C4(C)C)C3(C)O2)B2OC3CC4CC(C4(C)C)C3(C)O2)cccc1C(=O)O |
| InChI | InChI=1S/C35H50BNO8/c1-31(2)20-15-23(31)34(6)25(17-20)42-33(5,44-34)13-12-28(38)37-27(14-19-10-9-11-22(30(39)40)29(19)41-8)36-43-26-18-21-16-24(32(21,3)4)35(26,7)45-36/h9-11,20-21,23-27H,12-18H2,1-8H3,(H,37,38)(H,39,40) |
| InChIKey | DLWVCSALDYRETE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|