C29H35BN2O9 — CID 131749687
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[2-(3-cyanopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoate (PubChem CID 131749687) has the molecular formula C29H35BN2O9 and a molecular weight of 566.42 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[2-(3-cyanopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[2-(3-cyanopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 131749687 |
| Molecular Formula | C29H35BN2O9 |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[2-(3-cyanopropanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]-2-methoxybenzoate |
| SMILES | COc1c(CC(NC(=O)CCC#N)B2OC3CC4CC(C4(C)C)C3(C)O2)cccc1C(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C29H35BN2O9/c1-16-20(39-27(35)38-16)15-37-26(34)19-9-6-8-17(25(19)36-5)12-23(32-24(33)10-7-11-31)30-40-22-14-18-13-21(28(18,2)3)29(22,4)41-30/h6,8-9,18,21-23H,7,10,12-15H2,1-5H3,(H,32,33) |
| InChIKey | SEUSNODFSGQYOT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|