C27H40BNO6 — CID 131749785
butyl 2-methoxy-3-[2-(propanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate (PubChem CID 131749785) has the molecular formula C27H40BNO6 and a molecular weight of 485.43 g/mol. Its IUPAC name is butyl 2-methoxy-3-[2-(propanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate.
| Compound Name | butyl 2-methoxy-3-[2-(propanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 131749785 |
| Molecular Formula | C27H40BNO6 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | butyl 2-methoxy-3-[2-(propanoylamino)-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
| SMILES | CCCCOC(=O)c1cccc(CC(NC(=O)CC)B2OC3CC4CC(C4(C)C)C3(C)O2)c1OC |
| InChI | InChI=1S/C27H40BNO6/c1-7-9-13-33-25(31)19-12-10-11-17(24(19)32-6)14-22(29-23(30)8-2)28-34-21-16-18-15-20(26(18,3)4)27(21,5)35-28/h10-12,18,20-22H,7-9,13-16H2,1-6H3,(H,29,30) |
| InChIKey | AFWPMJRWQQFPLY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|