C31H39BN2O6 — CID 155607062
(7-prop-2-enoyl-7-azabicyclo[2.2.1]heptan-1-yl)methyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate (PubChem CID 155607062) has the molecular formula C31H39BN2O6 and a molecular weight of 546.47 g/mol. Its IUPAC name is (7-prop-2-enoyl-7-azabicyclo[2.2.1]heptan-1-yl)methyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate.
| Compound Name | (7-prop-2-enoyl-7-azabicyclo[2.2.1]heptan-1-yl)methyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 155607062 |
| Molecular Formula | C31H39BN2O6 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | (7-prop-2-enoyl-7-azabicyclo[2.2.1]heptan-1-yl)methyl N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
| SMILES | C=CC(=O)N1C2CCC1(COC(=O)N[C@@H](Cc1coc3ccccc13)B1O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O1)CC2 |
| InChI | InChI=1S/C31H39BN2O6/c1-5-27(35)34-21-10-12-31(34,13-11-21)18-38-28(36)33-26(14-19-17-37-23-9-7-6-8-22(19)23)32-39-25-16-20-15-24(29(20,2)3)30(25,4)40-32/h5-9,17,20-21,24-26H,1,10-16,18H2,2-4H3,(H,33,36)/t20-,21?,24-,25+,26-,30-,31?/m0/s1 |
| InChIKey | JPUPYUTYQJCDAC-IYJSRBKOSA-N |
| XLogP | 5.05 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|