C20H26BNO3 — CID 140861701
2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 140861701) has the molecular formula C20H26BNO3 and a molecular weight of 339.24 g/mol. Its IUPAC name is 2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | 2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 140861701 |
| Molecular Formula | C20H26BNO3 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB(C(N)Cc4coc5ccccc45)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C20H26BNO3/c1-19(2)13-9-16(19)20(3)17(10-13)24-21(25-20)18(22)8-12-11-23-15-7-5-4-6-14(12)15/h4-7,11,13,16-18H,8-10,22H2,1-3H3/t13-,16-,17+,18?,20-/m0/s1 |
| InChIKey | ZYRIASBMIUWMLX-JCNGHMNSSA-N |
| XLogP | 3.57 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|