C21H28BNO3 — CID 142595831
2-(1-benzofuran-3-yl)-N-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 142595831) has the molecular formula C21H28BNO3 and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-(1-benzofuran-3-yl)-N-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | 2-(1-benzofuran-3-yl)-N-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 142595831 |
| Molecular Formula | C21H28BNO3 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-(1-benzofuran-3-yl)-N-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | CNC(Cc1coc2ccccc12)B1O[C@@H]2CC3CC(C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C21H28BNO3/c1-20(2)14-10-17(20)21(3)18(11-14)25-22(26-21)19(23-4)9-13-12-24-16-8-6-5-7-15(13)16/h5-8,12,14,17-19,23H,9-11H2,1-4H3/t14?,17?,18-,19?,21+/m1/s1 |
| InChIKey | IDGRIULOGWMTSP-SZLMPCFRSA-N |
| XLogP | 3.83 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|