C31H37BFNO6S — CID 156806248
N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-1-[5-fluoro-2-(oxolan-2-yl)phenyl]methanesulfonamide (PubChem CID 156806248) has the molecular formula C31H37BFNO6S and a molecular weight of 581.52 g/mol. Its IUPAC name is N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-1-[5-fluoro-2-(oxolan-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-1-[5-fluoro-2-(oxolan-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 156806248 |
| Molecular Formula | C31H37BFNO6S |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-1-[5-fluoro-2-(oxolan-2-yl)phenyl]methanesulfonamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4coc5ccccc45)NS(=O)(=O)Cc4cc(F)ccc4C4CCCO4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C31H37BFNO6S/c1-30(2)21-15-27(30)31(3)28(16-21)39-32(40-31)29(14-19-17-38-26-8-5-4-7-23(19)26)34-41(35,36)18-20-13-22(33)10-11-24(20)25-9-6-12-37-25/h4-5,7-8,10-11,13,17,21,25,27-29,34H,6,9,12,14-16,18H2,1-3H3/t21-,25?,27-,28+,29-,31-/m0/s1 |
| InChIKey | ZRYRMVAHCDZGOD-JOBZIXDWSA-N |
| XLogP | 5.72 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|