C22H26BNO6S — CID 156806104
[(1R)-2-(1-benzofuran-3-yl)-1-[[2-(oxan-2-yl)phenyl]methylsulfonylamino]ethyl]boronic acid (PubChem CID 156806104) has the molecular formula C22H26BNO6S and a molecular weight of 443.33 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[2-(oxan-2-yl)phenyl]methylsulfonylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[2-(oxan-2-yl)phenyl]methylsulfonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 156806104 |
| Molecular Formula | C22H26BNO6S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[2-(oxan-2-yl)phenyl]methylsulfonylamino]ethyl]boronic acid |
| SMILES | O=S(=O)(Cc1ccccc1C1CCCCO1)N[C@@H](Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C22H26BNO6S/c25-23(26)22(13-17-14-30-21-10-4-3-9-19(17)21)24-31(27,28)15-16-7-1-2-8-18(16)20-11-5-6-12-29-20/h1-4,7-10,14,20,22,24-26H,5-6,11-13,15H2/t20?,22-/m0/s1 |
| InChIKey | SQFCCKLBWPMVSD-IAXKEJLGSA-N |
| XLogP | 2.72 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|