C17H16BClN2O7S — CID 156806074
[(1R)-2-(1-benzofuran-3-yl)-1-[(3-chloro-5-nitrophenyl)methylsulfonylamino]ethyl]boronic acid (PubChem CID 156806074) has the molecular formula C17H16BClN2O7S and a molecular weight of 438.65 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[(3-chloro-5-nitrophenyl)methylsulfonylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[(3-chloro-5-nitrophenyl)methylsulfonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 156806074 |
| Molecular Formula | C17H16BClN2O7S |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[(3-chloro-5-nitrophenyl)methylsulfonylamino]ethyl]boronic acid |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(CS(=O)(=O)N[C@@H](Cc2coc3ccccc23)B(O)O)c1 |
| InChI | InChI=1S/C17H16BClN2O7S/c19-13-5-11(6-14(8-13)21(24)25)10-29(26,27)20-17(18(22)23)7-12-9-28-16-4-2-1-3-15(12)16/h1-6,8-9,17,20,22-23H,7,10H2/t17-/m0/s1 |
| InChIKey | ZHNWVILJCVXLPX-KRWDZBQOSA-N |
| XLogP | 2.04 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|