C22H24BNO7S — CID 156806218
[(1R)-2-(1-benzofuran-3-yl)-1-(spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylmethylsulfonylamino)ethyl]boronic acid (PubChem CID 156806218) has the molecular formula C22H24BNO7S and a molecular weight of 457.31 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-(spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylmethylsulfonylamino)ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-(spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylmethylsulfonylamino)ethyl]boronic acid |
|---|---|
| PubChem CID | 156806218 |
| Molecular Formula | C22H24BNO7S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-(spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylmethylsulfonylamino)ethyl]boronic acid |
| SMILES | O=S(=O)(Cc1ccc2c(c1)COC21CCOC1)N[C@@H](Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C22H24BNO7S/c25-23(26)21(10-16-11-30-20-4-2-1-3-18(16)20)24-32(27,28)13-15-5-6-19-17(9-15)12-31-22(19)7-8-29-14-22/h1-6,9,11,21,24-26H,7-8,10,12-14H2/t21-,22?/m0/s1 |
| InChIKey | NJLCLCIWLWPATB-HMTLIYDFSA-N |
| XLogP | 1.62 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|