C17H15BClN3O5 — CID 175573277
[2-(1-benzofuran-3-yl)-1-[[2-[(4-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid (PubChem CID 175573277) has the molecular formula C17H15BClN3O5 and a molecular weight of 387.59 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[[2-[(4-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[[2-[(4-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 175573277 |
| Molecular Formula | C17H15BClN3O5 |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[[2-[(4-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]ethyl]boronic acid |
| SMILES | O=C(Nc1cc(Cl)ccn1)C(=O)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C17H15BClN3O5/c19-11-5-6-20-15(8-11)22-17(24)16(23)21-14(18(25)26)7-10-9-27-13-4-2-1-3-12(10)13/h1-6,8-9,14,25-26H,7H2,(H,21,23)(H,20,22,24) |
| InChIKey | JKOPJFQDEXDLDO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|