C29H38BN3O5 — CID 142596242
1-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl]urea (PubChem CID 142596242) has the molecular formula C29H38BN3O5 and a molecular weight of 519.45 g/mol. Its IUPAC name is 1-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl]urea.
| Compound Name | 1-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 142596242 |
| Molecular Formula | C29H38BN3O5 |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 1-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-1-prop-2-enoylpyrrolidin-2-yl]methyl]urea |
| SMILES | C=CC(=O)N1CCC[C@@H]1CNC(=O)N[C@@H](Cc1coc2ccccc12)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C29H38BN3O5/c1-5-26(34)33-12-8-9-20(33)16-31-27(35)32-25(13-18-17-36-22-11-7-6-10-21(18)22)30-37-24-15-19-14-23(28(19,2)3)29(24,4)38-30/h5-7,10-11,17,19-20,23-25H,1,8-9,12-16H2,2-4H3,(H2,31,32,35)/t19-,20+,23-,24+,25-,29-/m0/s1 |
| InChIKey | WIFRGTQVWMVWLN-WBCILHGASA-N |
| XLogP | 4.09 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|