C32H45BN4O4 — CID 163952400
1-[[(2S)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methyl]-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea (PubChem CID 163952400) has the molecular formula C32H45BN4O4 and a molecular weight of 560.55 g/mol. Its IUPAC name is 1-[[(2S)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methyl]-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea.
| Compound Name | 1-[[(2S)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methyl]-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 163952400 |
| Molecular Formula | C32H45BN4O4 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | 1-[[(2S)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methyl]-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea |
| SMILES | CC(C)C=C(C#N)C(=O)N1CCCC[C@H]1CNC(=O)N[C@@H](Cc1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C32H45BN4O4/c1-21(2)15-23(19-34)29(38)37-14-10-9-13-25(37)20-35-30(39)36-28(16-22-11-7-6-8-12-22)33-40-27-18-24-17-26(31(24,3)4)32(27,5)41-33/h6-8,11-12,15,21,24-28H,9-10,13-14,16-18,20H2,1-5H3,(H2,35,36,39)/t24-,25-,26-,27+,28-,32-/m0/s1 |
| InChIKey | ZAKNWOCTQHNNDN-GKWCIWIWSA-N |
| XLogP | 4.65 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|