C28H38BN3O4 — CID 142596255
2-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide (PubChem CID 142596255) has the molecular formula C28H38BN3O4 and a molecular weight of 491.44 g/mol. Its IUPAC name is 2-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide.
| Compound Name | 2-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 142596255 |
| Molecular Formula | C28H38BN3O4 |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 2-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4ccccc4)NC(=O)C[C@H]4CCCN(C(=O)CC#N)C4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C28H38BN3O4/c1-27(2)21-16-22(27)28(3)23(17-21)35-29(36-28)24(14-19-8-5-4-6-9-19)31-25(33)15-20-10-7-13-32(18-20)26(34)11-12-30/h4-6,8-9,20-24H,7,10-11,13-18H2,1-3H3,(H,31,33)/t20-,21+,22+,23-,24+,28+/m1/s1 |
| InChIKey | JVYXNPVFQYRUCM-VTGLQNAOSA-N |
| XLogP | 3.52 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|