C34H50BN3O5 — CID 174000689
[(3S)-1-(2-cyano-4,4-dimethylpentanoyl)piperidin-3-yl]methyl N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate (PubChem CID 174000689) has the molecular formula C34H50BN3O5 and a molecular weight of 591.60 g/mol. Its IUPAC name is [(3S)-1-(2-cyano-4,4-dimethylpentanoyl)piperidin-3-yl]methyl N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate.
| Compound Name | [(3S)-1-(2-cyano-4,4-dimethylpentanoyl)piperidin-3-yl]methyl N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 174000689 |
| Molecular Formula | C34H50BN3O5 |
| Molecular Weight | 591.60 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | [(3S)-1-(2-cyano-4,4-dimethylpentanoyl)piperidin-3-yl]methyl N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
| SMILES | Cc1ccc(C[C@H](NC(=O)OC[C@H]2CCCN(C(=O)C(C#N)CC(C)(C)C)C2)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C34H50BN3O5/c1-22-10-12-23(13-11-22)15-29(35-42-28-17-26-16-27(33(26,5)6)34(28,7)43-35)37-31(40)41-21-24-9-8-14-38(20-24)30(39)25(19-36)18-32(2,3)4/h10-13,24-29H,8-9,14-18,20-21H2,1-7H3,(H,37,40)/t24-,25?,26-,27-,28+,29-,34-/m0/s1 |
| InChIKey | NQDOOHYTMZKKDQ-ROJSWWQKSA-N |
| XLogP | 5.71 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|