C27H35BFN3O5 — CID 142596177
[(3S)-1-(2-cyanoacetyl)piperidin-3-yl] N-[(1R)-2-(4-fluorophenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate (PubChem CID 142596177) has the molecular formula C27H35BFN3O5 and a molecular weight of 511.40 g/mol. Its IUPAC name is [(3S)-1-(2-cyanoacetyl)piperidin-3-yl] N-[(1R)-2-(4-fluorophenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate.
| Compound Name | [(3S)-1-(2-cyanoacetyl)piperidin-3-yl] N-[(1R)-2-(4-fluorophenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 142596177 |
| Molecular Formula | C27H35BFN3O5 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | [(3S)-1-(2-cyanoacetyl)piperidin-3-yl] N-[(1R)-2-(4-fluorophenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamate |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4ccc(F)cc4)NC(=O)O[C@H]4CCCN(C(=O)CC#N)C4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C27H35BFN3O5/c1-26(2)18-14-21(26)27(3)22(15-18)36-28(37-27)23(13-17-6-8-19(29)9-7-17)31-25(34)35-20-5-4-12-32(16-20)24(33)10-11-30/h6-9,18,20-23H,4-5,10,12-16H2,1-3H3,(H,31,34)/t18-,20-,21-,22+,23-,27-/m0/s1 |
| InChIKey | IDNVVSBLRGKEAW-OOLMZSEQSA-N |
| XLogP | 3.64 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|