C29H41BN4O4 — CID 142596264
1-[[(2R)-1-(2-cyanoacetyl)piperidin-2-yl]methyl]-1-methyl-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea (PubChem CID 142596264) has the molecular formula C29H41BN4O4 and a molecular weight of 520.48 g/mol. Its IUPAC name is 1-[[(2R)-1-(2-cyanoacetyl)piperidin-2-yl]methyl]-1-methyl-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea.
| Compound Name | 1-[[(2R)-1-(2-cyanoacetyl)piperidin-2-yl]methyl]-1-methyl-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 142596264 |
| Molecular Formula | C29H41BN4O4 |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 1-[[(2R)-1-(2-cyanoacetyl)piperidin-2-yl]methyl]-1-methyl-3-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea |
| SMILES | CN(C[C@H]1CCCCN1C(=O)CC#N)C(=O)N[C@@H](Cc1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C29H41BN4O4/c1-28(2)21-17-23(28)29(3)24(18-21)37-30(38-29)25(16-20-10-6-5-7-11-20)32-27(36)33(4)19-22-12-8-9-15-34(22)26(35)13-14-31/h5-7,10-11,21-25H,8-9,12-13,15-19H2,1-4H3,(H,32,36)/t21-,22+,23-,24+,25-,29-/m0/s1 |
| InChIKey | MNUWUTVZMJZHIP-NMSYFLLASA-N |
| XLogP | 3.80 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|