C32H44BN3O4 — CID 150113648
3-[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide (PubChem CID 150113648) has the molecular formula C32H44BN3O4 and a molecular weight of 545.53 g/mol. Its IUPAC name is 3-[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide.
| Compound Name | 3-[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 150113648 |
| Molecular Formula | C32H44BN3O4 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | 3-[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide |
| SMILES | CC(C)C=C(C#N)C(=O)N1CCCC1CCC(=O)N[C@@H](Cc1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C32H44BN3O4/c1-21(2)16-23(20-34)30(38)36-15-9-12-25(36)13-14-29(37)35-28(17-22-10-7-6-8-11-22)33-39-27-19-24-18-26(31(24,3)4)32(27,5)40-33/h6-8,10-11,16,21,24-28H,9,12-15,17-19H2,1-5H3,(H,35,37)/t24-,25?,26-,27+,28-,32-/m0/s1 |
| InChIKey | DXUDAULUMFTTHA-PVPCNLLFSA-N |
| XLogP | 4.86 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|